Argininosuccinic acid

Argininosuccinic acid

IUPAC name N-[{[(4S)-4-amino-4-carboxybutyl]amino}(imino)methyl]-L-aspartic acid
Identifiers
CAS number	2387-71-5^N
PubChem	16950
ChemSpider	16059^Y
Jmol-3D images	Image 1
SMILES O=C(O)C[C@@H](C(=O)O)NC(=N/CCC[C@H](N)C(=O)O)/N
InChI InChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1^Y Key: KDZOASGQNOPSCU-WDSKDSINSA-N^Y InChI=1/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1 Key: KDZOASGQNOPSCU-WDSKDSINBJ
Properties
Molecular formula	C₁₀H₁₈N₄O₆
Molar mass	290.27 g mol⁻¹
N (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Argininosuccinic acid is a chemical compound that is a basic amino acid.

Reactions

Some cells synthesize argininosuccinic acid from citrulline and aspartic acid and use it as a precursor for arginine in the urea cycle or citrulline-NO cycle. The enzyme that catalyzes the reaction is argininosuccinate synthetase.

Argininosuccinic acid is a precursor to fumarate in the citric acid cycle via argininosuccinate lyase.